Products 1246818-76-7
CAS 1246818-76-7 is the registry number for Ganciclovir Mono-O-acetate-d5. Offered by: TRC. Available pack sizes: 50mg.
[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-1,1,2,3,3-pentadeuterio-3-hydroxypropyl] acetate (CAS 1246818-76-7) is a chemical compound with the molecular formula C11H15N5O5 and a molecular weight of 302.30 g/mol. IUPAC name: [2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-1,1,2,3,3-pentadeuterio-3-hydroxypropyl] acetate. InChIKey: YKLKCCHLLFMWQE-PLQZCBGVSA-N.
| Molecular formula | C11H15N5O5 |
|---|---|
| Molecular weight | 302.30 g/mol |
| IUPAC name | [2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-1,1,2,3,3-pentadeuterio-3-hydroxypropyl] acetate |
| InChIKey | YKLKCCHLLFMWQE-PLQZCBGVSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC(=O)C)OCN1C=NC2=C1N=C(NC2=O)N)O |
Computed by PubChem (NCBI)