Products 1246818-91-6
CAS 1246818-91-6 appears in our catalog under these names: 5-Hydroxy L-Tryptophan-d4 (Major), >95% (HPLC), L–5–Hydroxytryptophan–d4, L-5-Hydroxytryptophan-d4, 98.71%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg.
(2S)-2-amino-3-(2,4,6,7-tetradeuterio-5-hydroxy-1H-indol-3-yl)propanoic acid (CAS 1246818-91-6) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 224.25 g/mol. IUPAC name: (2S)-2-amino-3-(2,4,6,7-tetradeuterio-5-hydroxy-1H-indol-3-yl)propanoic acid. InChIKey: LDCYZAJDBXYCGN-RUTJMMHGSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | (2S)-2-amino-3-(2,4,6,7-tetradeuterio-5-hydroxy-1H-indol-3-yl)propanoic acid |
| InChIKey | LDCYZAJDBXYCGN-RUTJMMHGSA-N |
| SMILES | [2H]C1=C(C(=C(C2=C1NC(=C2C[C@@H](C(=O)O)N)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)