CAS 1276197-29-5 appears in our catalog under these names: L–5–Hydroxytryptophan–d3, L-5-Hydroxytryptophan-d3, 99.9%, 5-Hydroxy-L-tryptophan-4,6,7-d3, >95% (HPLC), 5-Hydroxy-L-tryptophan-4,6,7-d3 H2O, 99 atom % D, min 96% Chemical Purity. Offered by: GLPBio, MedChemExpress, TRC, CDN. Available pack sizes: 1mg, 5mg, 5 mg, 1 mg, 10mg, 0,01g, 0,005g.
(2S)-2-amino-3-(4,6,7-trideuterio-5-hydroxy-1H-indol-3-yl)propanoic acid (CAS 1276197-29-5) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 223.24 g/mol. IUPAC name: (2S)-2-amino-3-(4,6,7-trideuterio-5-hydroxy-1H-indol-3-yl)propanoic acid. InChIKey: LDCYZAJDBXYCGN-BSWQNAMISA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 223.24 g/mol |
| IUPAC name | (2S)-2-amino-3-(4,6,7-trideuterio-5-hydroxy-1H-indol-3-yl)propanoic acid |
| InChIKey | LDCYZAJDBXYCGN-BSWQNAMISA-N |
| SMILES | [2H]C1=C(C(=C(C2=C1NC=C2C[C@@H](C(=O)O)N)[2H])O)[2H] |
Computed by PubChem (NCBI)