Products 1246819-81-7
CAS 1246819-81-7 is the registry number for N-(Dimethylsulfamoyl)aniline-d5. Offered by: TRC. Available pack sizes: 100mg.
1,2,3,4,5-pentadeuterio-6-(dimethylsulfamoylamino)benzene (CAS 1246819-81-7) is a chemical compound with the molecular formula C8H12N2O2S and a molecular weight of 205.29 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(dimethylsulfamoylamino)benzene. InChIKey: QCDQDISRALTLNQ-DKFMXDSJSA-N.
| Molecular formula | C8H12N2O2S |
|---|---|
| Molecular weight | 205.29 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-(dimethylsulfamoylamino)benzene |
| InChIKey | QCDQDISRALTLNQ-DKFMXDSJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NS(=O)(=O)N(C)C)[2H])[2H] |
Computed by PubChem (NCBI)