Products 1246819-82-8
CAS 1246819-82-8 appears in our catalog under these names: Modafinil-d10 Carboxylate, >95% (HPLC), 2-(Benzhydrylsulfinyl)acetic acid-d10. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.
2-[bis(2,3,4,5,6-pentadeuteriophenyl)methylsulfinyl]acetic acid (CAS 1246819-82-8) is a chemical compound with the molecular formula C15H14O3S and a molecular weight of 284.40 g/mol. IUPAC name: 2-[bis(2,3,4,5,6-pentadeuteriophenyl)methylsulfinyl]acetic acid. InChIKey: QARQPIWTMBRJFX-LHNTUAQVSA-N.
| Molecular formula | C15H14O3S |
|---|---|
| Molecular weight | 284.40 g/mol |
| IUPAC name | 2-[bis(2,3,4,5,6-pentadeuteriophenyl)methylsulfinyl]acetic acid |
| InChIKey | QARQPIWTMBRJFX-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])S(=O)CC(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Modafinil-d10 Carboxylate