CAS 1246819-85-1 appears in our catalog under these names: Nor Propranolol-d7 Hydrochloride, Nor Propranolol-d7 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
1-amino-1,1,2,3,3-pentadeuterio-3-naphthalen-1-yloxypropan-2-ol;hydrochloride (CAS 1246819-85-1) is a chemical compound with the molecular formula C13H16ClNO2 and a molecular weight of 258.75 g/mol. IUPAC name: 1-amino-1,1,2,3,3-pentadeuterio-3-naphthalen-1-yloxypropan-2-ol;hydrochloride. InChIKey: QKMLNOYFLVRBEG-KNWWABDGSA-N.
| Molecular formula | C13H16ClNO2 |
|---|---|
| Molecular weight | 258.75 g/mol |
| IUPAC name | 1-amino-1,1,2,3,3-pentadeuterio-3-naphthalen-1-yloxypropan-2-ol;hydrochloride |
| InChIKey | QKMLNOYFLVRBEG-KNWWABDGSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC1=CC=CC2=CC=CC=C21)O)N.Cl |
Computed by PubChem (NCBI)