Products 1246820-82-5
CAS 1246820-82-5 appears in our catalog under these names: Tolfenamic Acid–d4, Tolfenamic Acid-d4, Tolfenamic Acid-d4, >95% (HPLC), Tolfenamic-d4 Acid (benzoic-3,4,5,6-d4), 98 atom % D, min 98% Chemical Purity. Offered by: GLPBio, Chemat Brand, TRC, CDN, MedChemExpress. Available pack sizes: 5mg, on request, 50mg, 0,01g, 0,005g, 1mg, 1 mg, 5 mg.
2-(3-chloro-2-methylanilino)-3,4,5,6-tetradeuteriobenzoic acid (CAS 1246820-82-5) is a chemical compound with the molecular formula C14H12ClNO2 and a molecular weight of 265.73 g/mol. IUPAC name: 2-(3-chloro-2-methylanilino)-3,4,5,6-tetradeuteriobenzoic acid. InChIKey: YEZNLOUZAIOMLT-IKMBEDGYSA-N.
| Molecular formula | C14H12ClNO2 |
|---|---|
| Molecular weight | 265.73 g/mol |
| IUPAC name | 2-(3-chloro-2-methylanilino)-3,4,5,6-tetradeuteriobenzoic acid |
| InChIKey | YEZNLOUZAIOMLT-IKMBEDGYSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)NC2=C(C(=CC=C2)Cl)C)[2H])[2H] |
Computed by PubChem (NCBI)