CAS 1246820-88-1 appears in our catalog under these names: Phenylpropylmethylamine-d3 Hydrochloride, Vonedrine-d3 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
2-phenyl-N-(trideuteriomethyl)propan-1-amine;hydrochloride (CAS 1246820-88-1) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 188.71 g/mol. IUPAC name: 2-phenyl-N-(trideuteriomethyl)propan-1-amine;hydrochloride. InChIKey: OQHDRLTXPGYYJN-MUTAZJQDSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 188.71 g/mol |
| IUPAC name | 2-phenyl-N-(trideuteriomethyl)propan-1-amine;hydrochloride |
| InChIKey | OQHDRLTXPGYYJN-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])NCC(C)C1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)