Products 1246912-03-7
CAS 1246912-03-7 is the registry number for Methyl phenidate D10. Offered by: TRC. Available pack sizes: 5mg.
Methyl 2-(2,3,3,4,4,5,5,6,6-nonadeuteriopiperidin-2-yl)-2-phenylacetate (CAS 1246912-03-7) is a chemical compound with the molecular formula C14H19NO2 and a molecular weight of 242.36 g/mol. IUPAC name: methyl 2-(2,3,3,4,4,5,5,6,6-nonadeuteriopiperidin-2-yl)-2-phenylacetate. InChIKey: DUGOZIWVEXMGBE-DNIAVSQBSA-N.
| Molecular formula | C14H19NO2 |
|---|---|
| Molecular weight | 242.36 g/mol |
| IUPAC name | methyl 2-(2,3,3,4,4,5,5,6,6-nonadeuteriopiperidin-2-yl)-2-phenylacetate |
| InChIKey | DUGOZIWVEXMGBE-DNIAVSQBSA-N |
| SMILES | [2H]C1(C(C(NC(C1([2H])[2H])([2H])C(C2=CC=CC=C2)C(=O)OC)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Methylphenidate-d9, Methylphenidate D10