CAS 1246912-08-2 is the registry number for 1-Amino-3-(naphthalen-1-yloxy)propan-1,1,2,3,3-d5-2-ol. Offered by: TRC. Available pack sizes: 25mg.
1-amino-1,1,2,3,3-pentadeuterio-3-naphthalen-1-yloxypropan-2-ol (CAS 1246912-08-2) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 222.29 g/mol. IUPAC name: 1-amino-1,1,2,3,3-pentadeuterio-3-naphthalen-1-yloxypropan-2-ol. InChIKey: ZFMCITCRZXLMDJ-QJHRKUAUSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 222.29 g/mol |
| IUPAC name | 1-amino-1,1,2,3,3-pentadeuterio-3-naphthalen-1-yloxypropan-2-ol |
| InChIKey | ZFMCITCRZXLMDJ-QJHRKUAUSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC1=CC=CC2=CC=CC=C21)O)N |
Computed by PubChem (NCBI)