CAS 1246912-17-3 is the registry number for Sotalol-d6. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
N-[4-[2-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)-1-hydroxyethyl]phenyl]methanesulfonamide (CAS 1246912-17-3) is a chemical compound with the molecular formula C12H20N2O3S and a molecular weight of 278.40 g/mol. IUPAC name: N-[4-[2-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)-1-hydroxyethyl]phenyl]methanesulfonamide. InChIKey: ZBMZVLHSJCTVON-WFGJKAKNSA-N.
| Molecular formula | C12H20N2O3S |
|---|---|
| Molecular weight | 278.40 g/mol |
| IUPAC name | N-[4-[2-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)-1-hydroxyethyl]phenyl]methanesulfonamide |
| InChIKey | ZBMZVLHSJCTVON-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])NCC(C1=CC=C(C=C1)NS(=O)(=O)C)O |
Computed by PubChem (NCBI)