CAS 404010-35-1 is the registry number for N–(3–Amino–2–methoxy–5–(2–methyl–2–propanyl)phenyl)methanesulfonamide. Offered by: GLPBio. Available pack sizes: 250mg.
N-(3-amino-5-tert-butyl-2-methoxyphenyl)methanesulfonamide (CAS 404010-35-1) is a chemical compound with the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. IUPAC name: N-(3-amino-5-tert-butyl-2-methoxyphenyl)methanesulfonamide. InChIKey: XNPVTUDLRVNVLW-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O3S |
|---|---|
| Molecular weight | 272.37 g/mol |
| IUPAC name | N-(3-amino-5-tert-butyl-2-methoxyphenyl)methanesulfonamide |
| InChIKey | XNPVTUDLRVNVLW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)NS(=O)(=O)C)OC)N |
Computed by PubChem (NCBI)