CAS 757221-64-0 is the registry number for 5-Amino-2-ethoxy-n,n-diethylbenzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
5-amino-2-ethoxy-N,N-diethylbenzenesulfonamide (CAS 757221-64-0) is a chemical compound with the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. IUPAC name: 5-amino-2-ethoxy-N,N-diethylbenzenesulfonamide. InChIKey: PGMYHXHFBXZAAU-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O3S |
|---|---|
| Molecular weight | 272.37 g/mol |
| IUPAC name | 5-amino-2-ethoxy-N,N-diethylbenzenesulfonamide |
| InChIKey | PGMYHXHFBXZAAU-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=C(C=CC(=C1)N)OCC |
Computed by PubChem (NCBI)