Products 1246937-74-5
CAS 1246937-74-5 is the registry number for tert-Butyl rel-(1R,4R,5R)-5-hydroxy-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1R,4R,5R)-5-hydroxy-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate (CAS 1246937-74-5) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. IUPAC name: tert-butyl (1R,4R,5R)-5-hydroxy-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate. InChIKey: MJGYJEPKIRWKJX-DJLDLDEBSA-N.
| Molecular formula | C11H17NO3 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | tert-butyl (1R,4R,5R)-5-hydroxy-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate |
| InChIKey | MJGYJEPKIRWKJX-DJLDLDEBSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2C[C@H]([C@H]1C=C2)O |
Computed by PubChem (NCBI)