Products 1247028-61-0
CAS 1247028-61-0 appears in our catalog under these names: Necrocide 1, Necrocide 1, 99.55%, Necrocide 1 98%, Necrocide 1, 98%, (S)-3-Cycloheptyl-3-(4-hydroxyphenyl)-6-methoxy-7-methylindolin-2-one, 98%. Offered by: GLPBio, MedChemExpress, Ambeed, BLDpharm, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 10mM/1mL, 100 mg, 5 mg, 25 mg.
(3S)-3-cycloheptyl-3-(4-hydroxyphenyl)-6-methoxy-7-methyl-1H-indol-2-one (CAS 1247028-61-0) is a chemical compound with the molecular formula C23H27NO3 and a molecular weight of 365.5 g/mol. IUPAC name: (3S)-3-cycloheptyl-3-(4-hydroxyphenyl)-6-methoxy-7-methyl-1H-indol-2-one. InChIKey: JLWDEIVDLTXBGE-QHCPKHFHSA-N.
| Molecular formula | C23H27NO3 |
|---|---|
| Molecular weight | 365.5 g/mol |
| IUPAC name | (3S)-3-cycloheptyl-3-(4-hydroxyphenyl)-6-methoxy-7-methyl-1H-indol-2-one |
| InChIKey | JLWDEIVDLTXBGE-QHCPKHFHSA-N |
| SMILES | CC1=C(C=CC2=C1NC(=O)[C@@]2(C3CCCCCC3)C4=CC=C(C=C4)O)OC |
Computed by PubChem (NCBI)