CAS 1247108-88-8 appears in our catalog under these names: 4-(Dimethyl-1H-1,2,4-triazol-1-yl)-2-methylbenzaldehyde, 95%, 4-(Dimethyl-1H-1,2,4-triazol-1-yl)-2-methylbenzaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-methylbenzaldehyde (CAS 1247108-88-8) is a chemical compound with the molecular formula C12H13N3O and a molecular weight of 215.25 g/mol. IUPAC name: 4-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-methylbenzaldehyde. InChIKey: KVJDLYYDYIVVQL-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 4-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-methylbenzaldehyde |
| InChIKey | KVJDLYYDYIVVQL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C(=NC(=N2)C)C)C=O |
Computed by PubChem (NCBI)