CAS 1247124-77-1 appears in our catalog under these names: 2–Chloro–4,6–bis(naphthalene–2–yl)–1,3,5–triazine, 2-Chloro-4,6-bis(naphthalene-2-yl)-1,3,5-triazine, 97%, 97%, 2-Chloro-4,6-bis(naphthalene-2-yl)-1,3,5-triazine, 96%, 2-Chloro-4,6-di(naphthalen-2-yl)-1,3,5-triazine, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 15g.
2-chloro-4,6-dinaphthalen-2-yl-1,3,5-triazine (CAS 1247124-77-1) is a chemical compound with the molecular formula C23H14ClN3 and a molecular weight of 367.8 g/mol. IUPAC name: 2-chloro-4,6-dinaphthalen-2-yl-1,3,5-triazine. InChIKey: CNJJVLLNTJDXEA-UHFFFAOYSA-N.
| Molecular formula | C23H14ClN3 |
|---|---|
| Molecular weight | 367.8 g/mol |
| IUPAC name | 2-chloro-4,6-dinaphthalen-2-yl-1,3,5-triazine |
| InChIKey | CNJJVLLNTJDXEA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=NC(=NC(=N3)Cl)C4=CC5=CC=CC=C5C=C4 |
Computed by PubChem (NCBI)