CAS 78941-32-9 appears in our catalog under these names: 2–Chloro–4,6–di(naphthalen–1–yl)–1,3,5–triazine, 2-Chloro-4,6-di(naphthalen-1-yl)-1,3,5-triazine, >98.0%(GC), 2-Chloro-4,6-di(naphthalen-1-yl)-1,3,5-triazine, 98%, 98%, 2-Chloro-4,6-di(naphthalen-1-yl)-1,3,5-triazine, 98%, 2-Chloro-4,6-di(naphthalen-1-yl)-1,3,5-triazine, 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 200mg, 100mg, 250mg.
2-chloro-4,6-dinaphthalen-1-yl-1,3,5-triazine (CAS 78941-32-9) is a chemical compound with the molecular formula C23H14ClN3 and a molecular weight of 367.8 g/mol. IUPAC name: 2-chloro-4,6-dinaphthalen-1-yl-1,3,5-triazine. InChIKey: KQKCYBIGRDRFJT-UHFFFAOYSA-N.
| Molecular formula | C23H14ClN3 |
|---|---|
| Molecular weight | 367.8 g/mol |
| IUPAC name | 2-chloro-4,6-dinaphthalen-1-yl-1,3,5-triazine |
| InChIKey | KQKCYBIGRDRFJT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=NC(=NC(=N3)Cl)C4=CC=CC5=CC=CC=C54 |
Computed by PubChem (NCBI)