CAS 1821147-80-1 is the registry number for 2-chloro-4-(phenanthren-9-yl)-6-phenyl-1,3,5-triazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-chloro-4-phenanthren-9-yl-6-phenyl-1,3,5-triazine (CAS 1821147-80-1) is a chemical compound with the molecular formula C23H14ClN3 and a molecular weight of 367.8 g/mol. IUPAC name: 2-chloro-4-phenanthren-9-yl-6-phenyl-1,3,5-triazine. InChIKey: ODRJUNRVHJGMAR-UHFFFAOYSA-N.
| Molecular formula | C23H14ClN3 |
|---|---|
| Molecular weight | 367.8 g/mol |
| IUPAC name | 2-chloro-4-phenanthren-9-yl-6-phenyl-1,3,5-triazine |
| InChIKey | ODRJUNRVHJGMAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)Cl)C3=CC4=CC=CC=C4C5=CC=CC=C53 |
Computed by PubChem (NCBI)