Products 1821147-80-1

CAS 1821147-80-1 is the registry number for 2-chloro-4-(phenanthren-9-yl)-6-phenyl-1,3,5-triazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-chloro-4-phenanthren-9-yl-6-phenyl-1,3,5-triazine (CAS 1821147-80-1) is a chemical compound with the molecular formula C23H14ClN3 and a molecular weight of 367.8 g/mol. IUPAC name: 2-chloro-4-phenanthren-9-yl-6-phenyl-1,3,5-triazine. InChIKey: ODRJUNRVHJGMAR-UHFFFAOYSA-N.

Identity
Molecular formulaC23H14ClN3
Molecular weight367.8 g/mol
IUPAC name2-chloro-4-phenanthren-9-yl-6-phenyl-1,3,5-triazine
InChIKeyODRJUNRVHJGMAR-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NC(=NC(=N2)Cl)C3=CC4=CC=CC=C4C5=CC=CC=C53

Computed by PubChem (NCBI)