CAS 1247559-91-6 is the registry number for Methyl 3-(3-bromophenyl)-2-methyl-3-oxopropanoate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 3-(3-bromophenyl)-2-methyl-3-oxopropanoate (CAS 1247559-91-6) is a chemical compound with the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. IUPAC name: methyl 3-(3-bromophenyl)-2-methyl-3-oxopropanoate. InChIKey: JUYOVOIEOBGHTH-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO3 |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | methyl 3-(3-bromophenyl)-2-methyl-3-oxopropanoate |
| InChIKey | JUYOVOIEOBGHTH-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=CC=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)