CAS 1247577-76-9 appears in our catalog under these names: 3-Bromo-2-isopropoxybenzoic acid, 95%, 3-Bromo-2-isopropoxybenzoic acid, 98%, 3-Bromo-2-isopropoxybenzoic acid, ≥95%, ≥95%, 3-Bromo-2-isopropoxybenzoic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
3-bromo-2-propan-2-yloxybenzoic acid (CAS 1247577-76-9) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: 3-bromo-2-propan-2-yloxybenzoic acid. InChIKey: RGKQTDRYBLRAKU-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 3-bromo-2-propan-2-yloxybenzoic acid |
| InChIKey | RGKQTDRYBLRAKU-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=CC=C1Br)C(=O)O |
Computed by PubChem (NCBI)