Products 1247669-93-7
CAS 1247669-93-7 is the registry number for 6-(4,5-Dimethyl-1H-imidazol-1-yl)pyridin-3-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(4,5-dimethylimidazol-1-yl)pyridin-3-amine (CAS 1247669-93-7) is a chemical compound with the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. IUPAC name: 6-(4,5-dimethylimidazol-1-yl)pyridin-3-amine. InChIKey: DGRSISJZUPZHPS-UHFFFAOYSA-N.
| Molecular formula | C10H12N4 |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 6-(4,5-dimethylimidazol-1-yl)pyridin-3-amine |
| InChIKey | DGRSISJZUPZHPS-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C=N1)C2=NC=C(C=C2)N)C |
Computed by PubChem (NCBI)