CAS 1247709-81-4 appears in our catalog under these names: 2-Amino-6-fluoro-N-methylbenzene-1-sulfonamide, 95%, 2-Amino-6-fluoro-N-methylbenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-amino-6-fluoro-N-methylbenzenesulfonamide (CAS 1247709-81-4) is a chemical compound with the molecular formula C7H9FN2O2S and a molecular weight of 204.22 g/mol. IUPAC name: 2-amino-6-fluoro-N-methylbenzenesulfonamide. InChIKey: KZTGGZYRLPDQLX-UHFFFAOYSA-N.
| Molecular formula | C7H9FN2O2S |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 2-amino-6-fluoro-N-methylbenzenesulfonamide |
| InChIKey | KZTGGZYRLPDQLX-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=C(C=CC=C1F)N |
Computed by PubChem (NCBI)