CAS 1247775-98-9 is the registry number for 3-(2,6-dimethylmorpholino)-4-methylaniline. Offered by: TRC. Available pack sizes: 2,5g.
3-(2,6-dimethylmorpholin-4-yl)-4-methylaniline (CAS 1247775-98-9) is a chemical compound with the molecular formula C13H20N2O and a molecular weight of 220.31 g/mol. IUPAC name: 3-(2,6-dimethylmorpholin-4-yl)-4-methylaniline. InChIKey: LPAADLNWSXVAFU-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | 3-(2,6-dimethylmorpholin-4-yl)-4-methylaniline |
| InChIKey | LPAADLNWSXVAFU-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)C2=C(C=CC(=C2)N)C |
Computed by PubChem (NCBI)