Products 1247883-69-7

CAS 1247883-69-7 is the registry number for 6,7-Dihydro-oxazolo[4,5-c]pyridine-2,5(4h)-dicarboxylic acid, 2-ethyl 5-(phenylmethyl) ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

5-O-benzyl 2-O-ethyl 6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridine-2,5-dicarboxylate (CAS 1247883-69-7) is a chemical compound with the molecular formula C17H18N2O5 and a molecular weight of 330.33 g/mol. IUPAC name: 5-O-benzyl 2-O-ethyl 6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridine-2,5-dicarboxylate. InChIKey: DTZBETUIKNRSJO-UHFFFAOYSA-N.

Identity
Molecular formulaC17H18N2O5
Molecular weight330.33 g/mol
IUPAC name5-O-benzyl 2-O-ethyl 6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridine-2,5-dicarboxylate
InChIKeyDTZBETUIKNRSJO-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NC2=C(O1)CCN(C2)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)