Products 206976-29-6

CAS 206976-29-6 is the registry number for Nicardipine Impurity 20. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Dimethyl 2,6-dimethyl-4-(3-nitrosophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 206976-29-6) is a chemical compound with the molecular formula C17H18N2O5 and a molecular weight of 330.33 g/mol. IUPAC name: dimethyl 2,6-dimethyl-4-(3-nitrosophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: WWXRWOZVVFUXSG-UHFFFAOYSA-N.

Identity
Molecular formulaC17H18N2O5
Molecular weight330.33 g/mol
IUPAC namedimethyl 2,6-dimethyl-4-(3-nitrosophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
InChIKeyWWXRWOZVVFUXSG-UHFFFAOYSA-N
SMILESCC1=C(C(C(=C(N1)C)C(=O)OC)C2=CC(=CC=C2)N=O)C(=O)OC

Computed by PubChem (NCBI)