CAS 19007-49-9 is the registry number for N-(2-(3,4-dimethoxyphenyl)ethyl)(2-nitrophenyl)formamide. Offered by: Biosynth. Available pack sizes: 10g, 25g.
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitrobenzamide (CAS 19007-49-9) is a chemical compound with the molecular formula C17H18N2O5 and a molecular weight of 330.33 g/mol. IUPAC name: N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitrobenzamide. InChIKey: YWFDPMZSVPNYHJ-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O5 |
|---|---|
| Molecular weight | 330.33 g/mol |
| IUPAC name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitrobenzamide |
| InChIKey | YWFDPMZSVPNYHJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CCNC(=O)C2=CC=CC=C2[N+](=O)[O-])OC |
Computed by PubChem (NCBI)