CAS 1247999-80-9 appears in our catalog under these names: 5-(2-(Furan-2-yl)ethyl)-4H-1,2,4-triazol-3-amine, 95%, 5-(2-(Furan-2-yl)ethyl)-4H-1,2,4-triazol-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-[2-(furan-2-yl)ethyl]-1H-1,2,4-triazol-3-amine (CAS 1247999-80-9) is a chemical compound with the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. IUPAC name: 5-[2-(furan-2-yl)ethyl]-1H-1,2,4-triazol-3-amine. InChIKey: LVQLNCUBNHFWNK-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 5-[2-(furan-2-yl)ethyl]-1H-1,2,4-triazol-3-amine |
| InChIKey | LVQLNCUBNHFWNK-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CCC2=NC(=NN2)N |
Computed by PubChem (NCBI)