Products 1248-43-7

CAS 1248-43-7 is the registry number for Octyl Benzyl Phthalate. Offered by: TRC. Available pack sizes: 500mg, 50mg.

Structural formula: {0} (CAS {1})

2-O-benzyl 1-O-octyl benzene-1,2-dicarboxylate (CAS 1248-43-7) is a chemical compound with the molecular formula C23H28O4 and a molecular weight of 368.5 g/mol. IUPAC name: 2-O-benzyl 1-O-octyl benzene-1,2-dicarboxylate. InChIKey: WHHSHXMIKFVAEK-UHFFFAOYSA-N.

Identity
Molecular formulaC23H28O4
Molecular weight368.5 g/mol
IUPAC name2-O-benzyl 1-O-octyl benzene-1,2-dicarboxylate
InChIKeyWHHSHXMIKFVAEK-UHFFFAOYSA-N
SMILESCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)