Products 30299-17-3

CAS 30299-17-3 is the registry number for Clinofibrate Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[4-[1-(4-hydroxyphenyl)cyclohexyl]phenoxy]-2-methylbutanoic acid (CAS 30299-17-3) is a chemical compound with the molecular formula C23H28O4 and a molecular weight of 368.5 g/mol. IUPAC name: 2-[4-[1-(4-hydroxyphenyl)cyclohexyl]phenoxy]-2-methylbutanoic acid. InChIKey: ARWMEFKFHXIAQR-UHFFFAOYSA-N.

Identity
Molecular formulaC23H28O4
Molecular weight368.5 g/mol
IUPAC name2-[4-[1-(4-hydroxyphenyl)cyclohexyl]phenoxy]-2-methylbutanoic acid
InChIKeyARWMEFKFHXIAQR-UHFFFAOYSA-N
SMILESCCC(C)(C(=O)O)OC1=CC=C(C=C1)C2(CCCCC2)C3=CC=C(C=C3)O

Computed by PubChem (NCBI)