Products 27215-22-1
CAS 27215-22-1 appears in our catalog under these names: Benzyl 2-ethylhexyl phthalate, 95%, Benzyl (6–methylheptyl) phthalate, Benzyl 2-Ethylhexyl Phthalate, ≥95%(GC), ≥95%(GC), Benzyl 2-ethylhexyl phthalate. Offered by: Combi-blocks, GLPBio, Chemat, HPC Standards. Available pack sizes: 5g, 25g, 1g, 1x1000mg.
1-O-(6-methylheptyl) 2-O-(4-methylphenyl) benzene-1,2-dicarboxylate (CAS 27215-22-1) is a chemical compound with the molecular formula C23H28O4 and a molecular weight of 368.5 g/mol. IUPAC name: 1-O-(6-methylheptyl) 2-O-(4-methylphenyl) benzene-1,2-dicarboxylate. InChIKey: OJTKBTGQAKWTED-UHFFFAOYSA-N.
| Molecular formula | C23H28O4 |
|---|---|
| Molecular weight | 368.5 g/mol |
| IUPAC name | 1-O-(6-methylheptyl) 2-O-(4-methylphenyl) benzene-1,2-dicarboxylate |
| InChIKey | OJTKBTGQAKWTED-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC(=O)C2=CC=CC=C2C(=O)OCCCCCC(C)C |
Computed by PubChem (NCBI)
Synonyms:
Benzyl isooctyl phthalate, Isooctyl benzyl phthalate, 1,2-Benzenedicarboxylic acid, isooctyl phenylmethyl ester, 1,2-Benzenedicarboxylic acid, 1-isooctyl 2-(phenylmethyl) ester, 1-O-(6-methylheptyl) 2-O-(4-methylphenyl) benzene-1,2-dicarboxylate, Benzyl 2-ethylhexyl phthalate(Technical), 6-methylheptyl 4-methylphenyl benzene-1,2-dicarboxylate