CAS 1248038-90-5 is the registry number for 3-(1H-pyrazol-1-yl)pyrazine-2-carbonitrile, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-pyrazol-1-ylpyrazine-2-carbonitrile (CAS 1248038-90-5) is a chemical compound with the molecular formula C8H5N5 and a molecular weight of 171.16 g/mol. IUPAC name: 3-pyrazol-1-ylpyrazine-2-carbonitrile. InChIKey: BLMOYLACGVEDMI-UHFFFAOYSA-N.
| Molecular formula | C8H5N5 |
|---|---|
| Molecular weight | 171.16 g/mol |
| IUPAC name | 3-pyrazol-1-ylpyrazine-2-carbonitrile |
| InChIKey | BLMOYLACGVEDMI-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=NC=CN=C2C#N |
Computed by PubChem (NCBI)