CAS 950769-00-3 appears in our catalog under these names: 2-(1H-1,2,4-Triazol-1-yl)pyridine-3-carbonitrile, 95%, 2-(1H-1,2,4-Triazol-1-yl)nicotinonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-(1,2,4-triazol-1-yl)pyridine-3-carbonitrile (CAS 950769-00-3) is a chemical compound with the molecular formula C8H5N5 and a molecular weight of 171.16 g/mol. IUPAC name: 2-(1,2,4-triazol-1-yl)pyridine-3-carbonitrile. InChIKey: DXMJLLQDQULJIK-UHFFFAOYSA-N.
| Molecular formula | C8H5N5 |
|---|---|
| Molecular weight | 171.16 g/mol |
| IUPAC name | 2-(1,2,4-triazol-1-yl)pyridine-3-carbonitrile |
| InChIKey | DXMJLLQDQULJIK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)N2C=NC=N2)C#N |
Computed by PubChem (NCBI)