CAS 1291486-07-1 is the registry number for 3-(1H-1,2,3,4-Tetrazol-1-yl)benzonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(tetrazol-1-yl)benzonitrile (CAS 1291486-07-1) is a chemical compound with the molecular formula C8H5N5 and a molecular weight of 171.16 g/mol. IUPAC name: 3-(tetrazol-1-yl)benzonitrile. InChIKey: PKRSGNRLLIKPLT-UHFFFAOYSA-N.
| Molecular formula | C8H5N5 |
|---|---|
| Molecular weight | 171.16 g/mol |
| IUPAC name | 3-(tetrazol-1-yl)benzonitrile |
| InChIKey | PKRSGNRLLIKPLT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C=NN=N2)C#N |
Computed by PubChem (NCBI)