CAS 1248118-80-0 is the registry number for 5-Cyano-2-methylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-cyano-2-methylbenzenesulfonamide (CAS 1248118-80-0) is a chemical compound with the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. IUPAC name: 5-cyano-2-methylbenzenesulfonamide. InChIKey: IAHUULOIHAFWOM-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 5-cyano-2-methylbenzenesulfonamide |
| InChIKey | IAHUULOIHAFWOM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C#N)S(=O)(=O)N |
Computed by PubChem (NCBI)