Products 1248210-12-9
CAS 1248210-12-9 appears in our catalog under these names: 1–(3–fluoro–4–methylphenyl)cyclopropan–1–amine hydrochloride, 1-(3-Fluoro-4-methylphenyl)cyclopropan-1-amine. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 500mg, 5g.
1-(3-fluoro-4-methylphenyl)cyclopropan-1-amine (CAS 1248210-12-9) is a chemical compound with the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. IUPAC name: 1-(3-fluoro-4-methylphenyl)cyclopropan-1-amine. InChIKey: BJXRKEGZXHLKHF-UHFFFAOYSA-N.
| Molecular formula | C10H12FN |
|---|---|
| Molecular weight | 165.21 g/mol |
| IUPAC name | 1-(3-fluoro-4-methylphenyl)cyclopropan-1-amine |
| InChIKey | BJXRKEGZXHLKHF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2(CC2)N)F |
Computed by PubChem (NCBI)