CAS 1248235-40-6 appears in our catalog under these names: 4-Methyl-2-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid, 95%, 4-Methyl-2-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-methyl-2-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid (CAS 1248235-40-6) is a chemical compound with the molecular formula C7H6F3NO2S and a molecular weight of 225.19 g/mol. IUPAC name: 4-methyl-2-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid. InChIKey: JYHPIPGZGVCHDG-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO2S |
|---|---|
| Molecular weight | 225.19 g/mol |
| IUPAC name | 4-methyl-2-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | JYHPIPGZGVCHDG-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)