Products 1248263-70-8
CAS 1248263-70-8 is the registry number for 3-Amino-1-(4-bromo-3-methylphenyl)pyrrolidin-2-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-amino-1-(4-bromo-3-methylphenyl)pyrrolidin-2-one (CAS 1248263-70-8) is a chemical compound with the molecular formula C11H13BrN2O and a molecular weight of 269.14 g/mol. IUPAC name: 3-amino-1-(4-bromo-3-methylphenyl)pyrrolidin-2-one. InChIKey: DSTFDWMELKKNBB-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2O |
|---|---|
| Molecular weight | 269.14 g/mol |
| IUPAC name | 3-amino-1-(4-bromo-3-methylphenyl)pyrrolidin-2-one |
| InChIKey | DSTFDWMELKKNBB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2CCC(C2=O)N)Br |
Computed by PubChem (NCBI)