Products 16058-93-8
CAS 16058-93-8 is the registry number for N4,N4-Dimethylbenzene-1,2,4-triamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-N,4-N-dimethylbenzene-1,2,4-triamine;hydrochloride (CAS 16058-93-8) is a chemical compound with the molecular formula C8H14ClN3 and a molecular weight of 187.67 g/mol. IUPAC name: 4-N,4-N-dimethylbenzene-1,2,4-triamine;hydrochloride. InChIKey: KXAOOUDHBWSADI-UHFFFAOYSA-N.
| Molecular formula | C8H14ClN3 |
|---|---|
| Molecular weight | 187.67 g/mol |
| IUPAC name | 4-N,4-N-dimethylbenzene-1,2,4-triamine;hydrochloride |
| InChIKey | KXAOOUDHBWSADI-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1)N)N.Cl |
Computed by PubChem (NCBI)