CAS 1248465-56-6 is the registry number for 2-(4-Bromo-2-nitrophenoxy)-n,n-dimethylethanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(4-bromo-2-nitrophenoxy)-N,N-dimethylethanamine (CAS 1248465-56-6) is a chemical compound with the molecular formula C10H13BrN2O3 and a molecular weight of 289.13 g/mol. IUPAC name: 2-(4-bromo-2-nitrophenoxy)-N,N-dimethylethanamine. InChIKey: FKMXIJZCKLFTKI-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O3 |
|---|---|
| Molecular weight | 289.13 g/mol |
| IUPAC name | 2-(4-bromo-2-nitrophenoxy)-N,N-dimethylethanamine |
| InChIKey | FKMXIJZCKLFTKI-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC1=C(C=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)