CAS 2639626-74-5 appears in our catalog under these names: 2-Amino-5-bromopyridin-3-yl tert-butyl carbonate, 95%, 2-Amino-5-bromo-3-pyridinyl 1,1-dimethylethyl carbonate, 97%, 97%, 2-Amino-5-bromo-3-pyridinyl 1,1-dimethylethyl carbonate, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
(2-amino-5-bromo-3-pyridinyl) tert-butyl carbonate (CAS 2639626-74-5) is a chemical compound with the molecular formula C10H13BrN2O3 and a molecular weight of 289.13 g/mol. IUPAC name: (2-amino-5-bromo-3-pyridinyl) tert-butyl carbonate. InChIKey: WPKNMNOMYHLDBJ-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O3 |
|---|---|
| Molecular weight | 289.13 g/mol |
| IUPAC name | (2-amino-5-bromo-3-pyridinyl) tert-butyl carbonate |
| InChIKey | WPKNMNOMYHLDBJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC1=C(N=CC(=C1)Br)N |
Computed by PubChem (NCBI)