CAS 1799922-12-5 is the registry number for 5-Bromo-2-(2,2-dimethoxyethyl)nicotinamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-(2,2-dimethoxyethyl)pyridine-3-carboxamide (CAS 1799922-12-5) is a chemical compound with the molecular formula C10H13BrN2O3 and a molecular weight of 289.13 g/mol. IUPAC name: 5-bromo-2-(2,2-dimethoxyethyl)pyridine-3-carboxamide. InChIKey: HPIBVJHOBFYTLU-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O3 |
|---|---|
| Molecular weight | 289.13 g/mol |
| IUPAC name | 5-bromo-2-(2,2-dimethoxyethyl)pyridine-3-carboxamide |
| InChIKey | HPIBVJHOBFYTLU-UHFFFAOYSA-N |
| SMILES | COC(CC1=C(C=C(C=N1)Br)C(=O)N)OC |
Computed by PubChem (NCBI)