CAS 1248643-89-1 is the registry number for (1-Acetylpiperidin-3-yl)methanesulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1-acetylpiperidin-3-yl)methanesulfonyl chloride (CAS 1248643-89-1) is a chemical compound with the molecular formula C8H14ClNO3S and a molecular weight of 239.72 g/mol. IUPAC name: (1-acetylpiperidin-3-yl)methanesulfonyl chloride. InChIKey: PLFHPFOOGKKIID-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNO3S |
|---|---|
| Molecular weight | 239.72 g/mol |
| IUPAC name | (1-acetylpiperidin-3-yl)methanesulfonyl chloride |
| InChIKey | PLFHPFOOGKKIID-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCCC(C1)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)