Products 919740-97-9
CAS 919740-97-9 is the registry number for N-(4-Chloro-1,1-dioxidotetrahydrothiophen-3-yl)isobutyramide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-chloro-1,1-dioxothiolan-3-yl)-2-methylpropanamide (CAS 919740-97-9) is a chemical compound with the molecular formula C8H14ClNO3S and a molecular weight of 239.72 g/mol. IUPAC name: N-(4-chloro-1,1-dioxothiolan-3-yl)-2-methylpropanamide. InChIKey: JRFOBWGVCJXGGA-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNO3S |
|---|---|
| Molecular weight | 239.72 g/mol |
| IUPAC name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-methylpropanamide |
| InChIKey | JRFOBWGVCJXGGA-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)NC1CS(=O)(=O)CC1Cl |
Computed by PubChem (NCBI)