Products 2375269-52-4
CAS 2375269-52-4 is the registry number for Ethyl 2-imino-2-oxo-2λ6-thiabicyclo(2.1.1)hexane-4-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 2-imino-2-oxo-2lambda6-thiabicyclo[2.1.1]hexane-4-carboxylate;hydrochloride (CAS 2375269-52-4) is a chemical compound with the molecular formula C8H14ClNO3S and a molecular weight of 239.72 g/mol. IUPAC name: ethyl 2-imino-2-oxo-2lambda6-thiabicyclo[2.1.1]hexane-4-carboxylate;hydrochloride. InChIKey: MYMMRKVAFHHTRR-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNO3S |
|---|---|
| Molecular weight | 239.72 g/mol |
| IUPAC name | ethyl 2-imino-2-oxo-2lambda6-thiabicyclo[2.1.1]hexane-4-carboxylate;hydrochloride |
| InChIKey | MYMMRKVAFHHTRR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C12CC(C1)S(=N)(=O)C2.Cl |
Computed by PubChem (NCBI)