CAS 1248756-57-1 is the registry number for 3-(3-Amino-4-methylphenyl)-4,5-dihydro-1H-1,2,4-triazol-5-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(3-amino-4-methylphenyl)-1,4-dihydro-1,2,4-triazol-5-one (CAS 1248756-57-1) is a chemical compound with the molecular formula C9H10N4O and a molecular weight of 190.20 g/mol. IUPAC name: 3-(3-amino-4-methylphenyl)-1,4-dihydro-1,2,4-triazol-5-one. InChIKey: LHDQGIBOUWGEEL-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 3-(3-amino-4-methylphenyl)-1,4-dihydro-1,2,4-triazol-5-one |
| InChIKey | LHDQGIBOUWGEEL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NNC(=O)N2)N |
Computed by PubChem (NCBI)