Products 1248924-74-4

CAS 1248924-74-4 is the registry number for Ethyl 2-(tert-butoxy)propanoate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

Ethyl 2-[(2-methylpropan-2-yl)oxy]propanoate (CAS 1248924-74-4) is a chemical compound with the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. IUPAC name: ethyl 2-[(2-methylpropan-2-yl)oxy]propanoate. InChIKey: WMDCTIWVKYQABP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18O3
Molecular weight174.24 g/mol
IUPAC nameethyl 2-[(2-methylpropan-2-yl)oxy]propanoate
InChIKeyWMDCTIWVKYQABP-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)OC(C)(C)C

Computed by PubChem (NCBI)