CAS 1249016-90-7 is the registry number for 1-(4-Bromo-2-chlorophenyl)guanidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(4-bromo-2-chlorophenyl)guanidine (CAS 1249016-90-7) is a chemical compound with the molecular formula C7H7BrClN3 and a molecular weight of 248.51 g/mol. IUPAC name: 2-(4-bromo-2-chlorophenyl)guanidine. InChIKey: STFQHQHJJXSZOT-UHFFFAOYSA-N.
| Molecular formula | C7H7BrClN3 |
|---|---|
| Molecular weight | 248.51 g/mol |
| IUPAC name | 2-(4-bromo-2-chlorophenyl)guanidine |
| InChIKey | STFQHQHJJXSZOT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Cl)N=C(N)N |
Computed by PubChem (NCBI)