CAS 1984136-38-0 is the registry number for 5-Bromo-3-methyl[1,2,4]triazolo[4,3-a]pyridine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyridine;hydrochloride (CAS 1984136-38-0) is a chemical compound with the molecular formula C7H7BrClN3 and a molecular weight of 248.51 g/mol. IUPAC name: 5-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyridine;hydrochloride. InChIKey: SUXSFCQCBYUHAI-UHFFFAOYSA-N.
| Molecular formula | C7H7BrClN3 |
|---|---|
| Molecular weight | 248.51 g/mol |
| IUPAC name | 5-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyridine;hydrochloride |
| InChIKey | SUXSFCQCBYUHAI-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C(=CC=C2)Br.Cl |
Computed by PubChem (NCBI)