Products 1416354-42-1
CAS 1416354-42-1 is the registry number for 5-Bromo-1H-pyrrolo[2,3-b]pyridin-3-amine hydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
5-bromo-1H-pyrrolo[2,3-b]pyridin-3-amine;hydrochloride (CAS 1416354-42-1) is a chemical compound with the molecular formula C7H7BrClN3 and a molecular weight of 248.51 g/mol. IUPAC name: 5-bromo-1H-pyrrolo[2,3-b]pyridin-3-amine;hydrochloride. InChIKey: VGHMOUGLZJHWLN-UHFFFAOYSA-N.
| Molecular formula | C7H7BrClN3 |
|---|---|
| Molecular weight | 248.51 g/mol |
| IUPAC name | 5-bromo-1H-pyrrolo[2,3-b]pyridin-3-amine;hydrochloride |
| InChIKey | VGHMOUGLZJHWLN-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=CN2)N)Br.Cl |
Computed by PubChem (NCBI)